C34H37ClF3N7O7 — CID 161180958
(2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-4-[[4-(oxan-3-yl)-2-oxobutanoyl]amino]butanoic acid (PubChem CID 161180958) has the molecular formula C34H37ClF3N7O7 and a molecular weight of 748.16 g/mol. Its IUPAC name is (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-4-[[4-(oxan-3-yl)-2-oxobutanoyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-4-[[4-(oxan-3-yl)-2-oxobutanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 161180958 |
| Molecular Formula | C34H37ClF3N7O7 |
| Molecular Weight | 748.16 g/mol |
| Exact Mass | 747.24 |
| IUPAC Name | (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-4-[[4-(oxan-3-yl)-2-oxobutanoyl]amino]butanoic acid |
| SMILES | O=C(CCC1CCCOC1)C(=O)NCC[C@H](NC(=O)c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1)C(=O)O |
| InChI | InChI=1S/C34H37ClF3N7O7/c35-23-8-6-22(7-9-23)33(14-15-33)45-31-42-30(43-32(44-31)52-19-34(36,37)38)40-24-10-4-21(5-11-24)27(47)41-25(29(49)50)13-16-39-28(48)26(46)12-3-20-2-1-17-51-18-20/h4-11,20,25H,1-3,12-19H2,(H,39,48)(H,41,47)(H,49,50)(H2,40,42,43,44,45)/t20?,25-/m0/s1 |
| InChIKey | USLGMPPJMCLICI-KUXBLMNESA-N |
| XLogP | 4.78 |
| TPSA | 193.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.16 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|