C33H35ClF3N7O7 — CID 158676415
(2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-6-(oxan-3-ylmethylamino)-5,6-dioxohexanoic acid (PubChem CID 158676415) has the molecular formula C33H35ClF3N7O7 and a molecular weight of 734.13 g/mol. Its IUPAC name is (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-6-(oxan-3-ylmethylamino)-5,6-dioxohexanoic acid.
| Compound Name | (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-6-(oxan-3-ylmethylamino)-5,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 158676415 |
| Molecular Formula | C33H35ClF3N7O7 |
| Molecular Weight | 734.13 g/mol |
| Exact Mass | 733.22 |
| IUPAC Name | (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-6-(oxan-3-ylmethylamino)-5,6-dioxohexanoic acid |
| SMILES | O=C(CC[C@H](NC(=O)c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1)C(=O)O)C(=O)NCC1CCCOC1 |
| InChI | InChI=1S/C33H35ClF3N7O7/c34-22-7-5-21(6-8-22)32(13-14-32)44-30-41-29(42-31(43-30)51-18-33(35,36)37)39-23-9-3-20(4-10-23)26(46)40-24(28(48)49)11-12-25(45)27(47)38-16-19-2-1-15-50-17-19/h3-10,19,24H,1-2,11-18H2,(H,38,47)(H,40,46)(H,48,49)(H2,39,41,42,43,44)/t19?,24-/m0/s1 |
| InChIKey | IEOOWYLPKWZPEQ-WIIYFNMSSA-N |
| XLogP | 4.39 |
| TPSA | 193.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.13 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|