C29H31ClF3N7O5S — CID 56839127
4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[5-(cyclopropylsulfonylamino)-5-oxopentyl]benzamide (PubChem CID 56839127) has the molecular formula C29H31ClF3N7O5S and a molecular weight of 682.12 g/mol. Its IUPAC name is 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[5-(cyclopropylsulfonylamino)-5-oxopentyl]benzamide.
| Compound Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[5-(cyclopropylsulfonylamino)-5-oxopentyl]benzamide |
|---|---|
| PubChem CID | 56839127 |
| Molecular Formula | C29H31ClF3N7O5S |
| Molecular Weight | 682.12 g/mol |
| Exact Mass | 681.17 |
| IUPAC Name | 4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-[5-(cyclopropylsulfonylamino)-5-oxopentyl]benzamide |
| SMILES | O=C(CCCCNC(=O)c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C29H31ClF3N7O5S/c30-20-8-6-19(7-9-20)28(14-15-28)39-26-36-25(37-27(38-26)45-17-29(31,32)33)35-21-10-4-18(5-11-21)24(42)34-16-2-1-3-23(41)40-46(43,44)22-12-13-22/h4-11,22H,1-3,12-17H2,(H,34,42)(H,40,41)(H2,35,36,37,38,39) |
| InChIKey | NETPAMCEGYHEBQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 164.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.12 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|