C30H27ClF3N7O7 — CID 90304413
methyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]propanoate (PubChem CID 90304413) has the molecular formula C30H27ClF3N7O7 and a molecular weight of 690.03 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]propanoate.
| Compound Name | methyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]propanoate |
|---|---|
| PubChem CID | 90304413 |
| Molecular Formula | C30H27ClF3N7O7 |
| Molecular Weight | 690.03 g/mol |
| Exact Mass | 689.16 |
| IUPAC Name | methyl (2S)-2-[[4-[[4-[[1-(4-chlorophenyl)cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]propanoate |
| SMILES | COC(=O)[C@H](CNc1c(OC)c(=O)c1=O)NC(=O)c1ccc(Nc2nc(NC3(c4ccc(Cl)cc4)CC3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C30H27ClF3N7O7/c1-46-23-20(21(42)22(23)43)35-13-19(25(45)47-2)37-24(44)15-3-9-18(10-4-15)36-26-38-27(40-28(39-26)48-14-30(32,33)34)41-29(11-12-29)16-5-7-17(31)8-6-16/h3-10,19,35H,11-14H2,1-2H3,(H,37,44)(H2,36,38,39,40,41)/t19-/m0/s1 |
| InChIKey | OXACZHMIVGXSBX-IBGZPJMESA-N |
| XLogP | 3.30 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.03 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|