C32H39BrF3N7O5 — CID 68658484
tert-butyl N-[3-[[4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propyl]carbamate (PubChem CID 68658484) has the molecular formula C32H39BrF3N7O5 and a molecular weight of 738.61 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 68658484 |
| Molecular Formula | C32H39BrF3N7O5 |
| Molecular Weight | 738.61 g/mol |
| Exact Mass | 737.21 |
| IUPAC Name | tert-butyl N-[3-[[4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(=O)c1ccc(Nc2nc(NC3(c4ccc(OCCCBr)cc4)CC3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C32H39BrF3N7O5/c1-30(2,3)48-29(45)38-18-5-17-37-25(44)21-6-10-23(11-7-21)39-26-40-27(42-28(41-26)47-20-32(34,35)36)43-31(14-15-31)22-8-12-24(13-9-22)46-19-4-16-33/h6-13H,4-5,14-20H2,1-3H3,(H,37,44)(H,38,45)(H2,39,40,41,42,43) |
| InChIKey | MREOCDNFDGGVEF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|