C26H30BrN5O4 — CID 136642909
tert-butyl 4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 136642909) has the molecular formula C26H30BrN5O4 and a molecular weight of 556.46 g/mol. Its IUPAC name is tert-butyl 4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | tert-butyl 4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 136642909 |
| Molecular Formula | C26H30BrN5O4 |
| Molecular Weight | 556.46 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | tert-butyl 4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(Nc2nc(NC3(c4ccc(OCCCBr)cc4)CC3)nc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C26H30BrN5O4/c1-25(2,3)36-21(33)17-5-9-19(10-6-17)28-22-29-23(31-24(34)30-22)32-26(13-14-26)18-7-11-20(12-8-18)35-16-4-15-27/h5-12H,4,13-16H2,1-3H3,(H3,28,29,30,31,32,34) |
| InChIKey | ZONNLOMTXZCFSW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|