C32H48N6O5Si2 — CID 123312603
tert-butyl 4-[[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-6-[3-[methyl(trimethylsilyloxy)silyl]propylamino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 123312603) has the molecular formula C32H48N6O5Si2 and a molecular weight of 652.95 g/mol. Its IUPAC name is tert-butyl 4-[[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-6-[3-[methyl(trimethylsilyloxy)silyl]propylamino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | tert-butyl 4-[[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-6-[3-[methyl(trimethylsilyloxy)silyl]propylamino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 123312603 |
| Molecular Formula | C32H48N6O5Si2 |
| Molecular Weight | 652.95 g/mol |
| Exact Mass | 652.32 |
| IUPAC Name | tert-butyl 4-[[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]anilino]-6-[3-[methyl(trimethylsilyloxy)silyl]propylamino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | C[SiH](CCCNc1nc(Nc2ccc(C(=O)OC(C)(C)C)cc2)nc(Nc2ccc(C(=O)OC(C)(C)C)cc2)n1)O[Si](C)(C)C |
| InChI | InChI=1S/C32H48N6O5Si2/c1-31(2,3)41-26(39)22-12-16-24(17-13-22)34-29-36-28(33-20-11-21-44(7)43-45(8,9)10)37-30(38-29)35-25-18-14-23(15-19-25)27(40)42-32(4,5)6/h12-19,44H,11,20-21H2,1-10H3,(H3,33,34,35,36,37,38) |
| InChIKey | JYLXDXVYUPLMPP-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.95 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|