C34H54N6O6Si3 — CID 147601112
butyl 4-[[4-(4-butoxycarbonylanilino)-6-[3-(dimethylsilyloxy-methyl-trimethylsilyloxysilyl)propylamino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 147601112) has the molecular formula C34H54N6O6Si3 and a molecular weight of 727.10 g/mol. Its IUPAC name is butyl 4-[[4-(4-butoxycarbonylanilino)-6-[3-(dimethylsilyloxy-methyl-trimethylsilyloxysilyl)propylamino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | butyl 4-[[4-(4-butoxycarbonylanilino)-6-[3-(dimethylsilyloxy-methyl-trimethylsilyloxysilyl)propylamino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 147601112 |
| Molecular Formula | C34H54N6O6Si3 |
| Molecular Weight | 727.10 g/mol |
| Exact Mass | 726.34 |
| IUPAC Name | butyl 4-[[4-(4-butoxycarbonylanilino)-6-[3-(dimethylsilyloxy-methyl-trimethylsilyloxysilyl)propylamino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(Nc2nc(NCCC[Si](C)(O[SiH](C)C)O[Si](C)(C)C)nc(Nc3ccc(C(=O)OCCCC)cc3)n2)cc1 |
| InChI | InChI=1S/C34H54N6O6Si3/c1-9-11-23-43-30(41)26-14-18-28(19-15-26)36-33-38-32(35-22-13-25-49(8,45-47(3)4)46-48(5,6)7)39-34(40-33)37-29-20-16-27(17-21-29)31(42)44-24-12-10-2/h14-21,47H,9-13,22-25H2,1-8H3,(H3,35,36,37,38,39,40) |
| InChIKey | GADVQMDBXXQSFC-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.10 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|