C39H42N10O6 — CID 15983367
butyl 4-[[7,11-bis(4-butoxycarbonylanilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]amino]benzoate (PubChem CID 15983367) has the molecular formula C39H42N10O6 and a molecular weight of 746.83 g/mol. Its IUPAC name is butyl 4-[[7,11-bis(4-butoxycarbonylanilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]amino]benzoate.
| Compound Name | butyl 4-[[7,11-bis(4-butoxycarbonylanilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 15983367 |
| Molecular Formula | C39H42N10O6 |
| Molecular Weight | 746.83 g/mol |
| Exact Mass | 746.33 |
| IUPAC Name | butyl 4-[[7,11-bis(4-butoxycarbonylanilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC2=NC3=NC(Nc4ccc(C(=O)OCCCC)cc4)=NC4=NC(Nc5ccc(C(=O)OCCCC)cc5)=NC(=N2)N34)cc1 |
| InChI | InChI=1S/C39H42N10O6/c1-4-7-22-53-31(50)25-10-16-28(17-11-25)40-34-43-37-45-35(41-29-18-12-26(13-19-29)32(51)54-23-8-5-2)47-39-48-36(46-38(44-34)49(37)39)42-30-20-14-27(15-21-30)33(52)55-24-9-6-3/h10-21H,4-9,22-24H2,1-3H3,(H3,40,41,42,43,44,45,46,47,48) |
| InChIKey | AIFAZTXYFATYDN-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 192.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.83 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|