C75H114N10O6 — CID 87495176
hexadecan-7-yl 4-[[7,11-bis(4-hexadecan-7-yloxycarbonylanilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]amino]benzoate (PubChem CID 87495176) has the molecular formula C75H114N10O6 and a molecular weight of 1251.80 g/mol. Its IUPAC name is hexadecan-7-yl 4-[[7,11-bis(4-hexadecan-7-yloxycarbonylanilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]amino]benzoate.
| Compound Name | hexadecan-7-yl 4-[[7,11-bis(4-hexadecan-7-yloxycarbonylanilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 87495176 |
| Molecular Formula | C75H114N10O6 |
| Molecular Weight | 1251.80 g/mol |
| Exact Mass | 1250.89 |
| IUPAC Name | hexadecan-7-yl 4-[[7,11-bis(4-hexadecan-7-yloxycarbonylanilino)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]amino]benzoate |
| SMILES | CCCCCCCCCC(CCCCCC)OC(=O)c1ccc(NC2=NC3=NC(Nc4ccc(C(=O)OC(CCCCCC)CCCCCCCCC)cc4)=NC4=NC(Nc5ccc(C(=O)OC(CCCCCC)CCCCCCCCC)cc5)=NC(=N2)N34)cc1 |
| InChI | InChI=1S/C75H114N10O6/c1-7-13-19-25-28-31-37-43-64(40-34-22-16-10-4)89-67(86)58-46-52-61(53-47-58)76-70-79-73-81-71(77-62-54-48-59(49-55-62)68(87)90-65(41-35-23-17-11-5)44-38-32-29-26-20-14-8-2)83-75-84-72(82-74(80-70)85(73)75)78-63-56-50-60(51-57-63)69(88)91-66(42-36-24-18-12-6)45-39-33-30-27-21-15-9-3/h46-57,64-66H,7-45H2,1-6H3,(H3,76,77,78,79,80,81,82,83,84) |
| InChIKey | KZKXDEIDIWDTIA-UHFFFAOYSA-N |
| XLogP | 20.71 |
| TPSA | 192.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 91 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1251.80 |
| LogP ≤ 5 | 20.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|