C14H16N2O2S2 — CID 122707208
butyl 4-[(2-sulfanylidene-5H-1,3-thiazol-4-yl)amino]benzoate (PubChem CID 122707208) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is butyl 4-[(2-sulfanylidene-5H-1,3-thiazol-4-yl)amino]benzoate.
| Compound Name | butyl 4-[(2-sulfanylidene-5H-1,3-thiazol-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 122707208 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | butyl 4-[(2-sulfanylidene-5H-1,3-thiazol-4-yl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC2=NC(=S)SC2)cc1 |
| InChI | InChI=1S/C14H16N2O2S2/c1-2-3-8-18-13(17)10-4-6-11(7-5-10)15-12-9-20-14(19)16-12/h4-7H,2-3,8-9H2,1H3,(H,15,16,19) |
| InChIKey | UEJSLSSVUAMQHI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|