C14H15NO3S2 — CID 122707194
butyl 4-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzoate (PubChem CID 122707194) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is butyl 4-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzoate.
| Compound Name | butyl 4-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzoate |
|---|---|
| PubChem CID | 122707194 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | butyl 4-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)CSC2=S)cc1 |
| InChI | InChI=1S/C14H15NO3S2/c1-2-3-8-18-13(17)10-4-6-11(7-5-10)15-12(16)9-20-14(15)19/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | XYSCNZXWHSDNJH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|