C13H13NO4S — CID 2732377
ethyl 4-(3,5-dioxothiomorpholin-4-yl)benzoate (PubChem CID 2732377) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is ethyl 4-(3,5-dioxothiomorpholin-4-yl)benzoate.
| Compound Name | ethyl 4-(3,5-dioxothiomorpholin-4-yl)benzoate |
|---|---|
| PubChem CID | 2732377 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | ethyl 4-(3,5-dioxothiomorpholin-4-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CSCC2=O)cc1 |
| InChI | InChI=1S/C13H13NO4S/c1-2-18-13(17)9-3-5-10(6-4-9)14-11(15)7-19-8-12(14)16/h3-6H,2,7-8H2,1H3 |
| InChIKey | DPBQUURQOOBEID-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|