C12H12N2O3S — CID 10467980
ethyl 4-(5-oxo-2-sulfanylideneimidazolidin-1-yl)benzoate (PubChem CID 10467980) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is ethyl 4-(5-oxo-2-sulfanylideneimidazolidin-1-yl)benzoate.
| Compound Name | ethyl 4-(5-oxo-2-sulfanylideneimidazolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 10467980 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | ethyl 4-(5-oxo-2-sulfanylideneimidazolidin-1-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CNC2=S)cc1 |
| InChI | InChI=1S/C12H12N2O3S/c1-2-17-11(16)8-3-5-9(6-4-8)14-10(15)7-13-12(14)18/h3-6H,2,7H2,1H3,(H,13,18) |
| InChIKey | SOSREMAFJMWFIV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|