C18H18N2O3S2 — CID 4187950
ethyl 4-[3-[(3-methylthiophen-2-yl)methyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate (PubChem CID 4187950) has the molecular formula C18H18N2O3S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is ethyl 4-[3-[(3-methylthiophen-2-yl)methyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(3-methylthiophen-2-yl)methyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 4187950 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | ethyl 4-[3-[(3-methylthiophen-2-yl)methyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CN(Cc3sccc3C)C2=S)cc1 |
| InChI | InChI=1S/C18H18N2O3S2/c1-3-23-17(22)13-4-6-14(7-5-13)20-16(21)11-19(18(20)24)10-15-12(2)8-9-25-15/h4-9H,3,10-11H2,1-2H3 |
| InChIKey | JZCWFHDXFMNONY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|