C17H17Br2NO4 — CID 124724602
ethyl 4-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 124724602) has the molecular formula C17H17Br2NO4 and a molecular weight of 459.13 g/mol. Its IUPAC name is ethyl 4-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | ethyl 4-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 124724602 |
| Molecular Formula | C17H17Br2NO4 |
| Molecular Weight | 459.13 g/mol |
| Exact Mass | 456.95 |
| IUPAC Name | ethyl 4-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3C[C@H](Br)[C@@H](Br)C[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C17H17Br2NO4/c1-2-24-17(23)9-3-5-10(6-4-9)20-15(21)11-7-13(18)14(19)8-12(11)16(20)22/h3-6,11-14H,2,7-8H2,1H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | ZMCAMQAZBWWFOZ-MQYQWHSLSA-N |
| XLogP | 3.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|