C25H33Br2NO4 — CID 124715274
decyl 4-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 124715274) has the molecular formula C25H33Br2NO4 and a molecular weight of 571.35 g/mol. Its IUPAC name is decyl 4-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | decyl 4-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 124715274 |
| Molecular Formula | C25H33Br2NO4 |
| Molecular Weight | 571.35 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | decyl 4-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc(N2C(=O)[C@@H]3C[C@H](Br)[C@@H](Br)C[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C25H33Br2NO4/c1-2-3-4-5-6-7-8-9-14-32-25(31)17-10-12-18(13-11-17)28-23(29)19-15-21(26)22(27)16-20(19)24(28)30/h10-13,19-22H,2-9,14-16H2,1H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | OJPWKHHDOHXTPS-CZYKHXBRSA-N |
| XLogP | 6.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.35 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|