C21H23Br2NO5 — CID 19646226
(3,3-dimethyl-2-oxobutyl) 4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate (PubChem CID 19646226) has the molecular formula C21H23Br2NO5 and a molecular weight of 529.23 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 19646226 |
| Molecular Formula | C21H23Br2NO5 |
| Molecular Weight | 529.23 g/mol |
| Exact Mass | 526.99 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 4-(5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1ccc(N2C(=O)C3CC(Br)C(Br)CC3C2=O)cc1 |
| InChI | InChI=1S/C21H23Br2NO5/c1-21(2,3)17(25)10-29-20(28)11-4-6-12(7-5-11)24-18(26)13-8-15(22)16(23)9-14(13)19(24)27/h4-7,13-16H,8-10H2,1-3H3 |
| InChIKey | JPMQDNFWJSIWQC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|