C31H25Br2NO7 — CID 124678258
[4-[2-[4-[(3aR,5S,6S,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoyl]oxyacetyl]phenyl] 4-methylbenzoate (PubChem CID 124678258) has the molecular formula C31H25Br2NO7 and a molecular weight of 683.35 g/mol. Its IUPAC name is [4-[2-[4-[(3aR,5S,6S,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoyl]oxyacetyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[2-[4-[(3aR,5S,6S,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoyl]oxyacetyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 124678258 |
| Molecular Formula | C31H25Br2NO7 |
| Molecular Weight | 683.35 g/mol |
| Exact Mass | 681.00 |
| IUPAC Name | [4-[2-[4-[(3aR,5S,6S,7aS)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoyl]oxyacetyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(=O)COC(=O)c3ccc(N4C(=O)[C@H]5C[C@H](Br)[C@@H](Br)C[C@H]5C4=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H25Br2NO7/c1-17-2-4-20(5-3-17)31(39)41-22-12-8-18(9-13-22)27(35)16-40-30(38)19-6-10-21(11-7-19)34-28(36)23-14-25(32)26(33)15-24(23)29(34)37/h2-13,23-26H,14-16H2,1H3/t23-,24+,25-,26-/m0/s1 |
| InChIKey | JHKJDVOEKAVXOC-QYOOZWMWSA-N |
| XLogP | 5.68 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.35 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|