C21H19Br2NO3 — CID 124717686
(3aR,5S,6S,7aR)-5,6-dibromo-2-[4-(4-methylphenoxy)phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 124717686) has the molecular formula C21H19Br2NO3 and a molecular weight of 493.20 g/mol. Its IUPAC name is (3aR,5S,6S,7aR)-5,6-dibromo-2-[4-(4-methylphenoxy)phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,5S,6S,7aR)-5,6-dibromo-2-[4-(4-methylphenoxy)phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124717686 |
| Molecular Formula | C21H19Br2NO3 |
| Molecular Weight | 493.20 g/mol |
| Exact Mass | 490.97 |
| IUPAC Name | (3aR,5S,6S,7aR)-5,6-dibromo-2-[4-(4-methylphenoxy)phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)[C@@H]4C[C@H](Br)[C@@H](Br)C[C@H]4C3=O)cc2)cc1 |
| InChI | InChI=1S/C21H19Br2NO3/c1-12-2-6-14(7-3-12)27-15-8-4-13(5-9-15)24-20(25)16-10-18(22)19(23)11-17(16)21(24)26/h2-9,16-19H,10-11H2,1H3/t16-,17-,18+,19+/m1/s1 |
| InChIKey | YFBVFRGPUZJOKR-YRXWBPOGSA-N |
| XLogP | 5.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.20 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|