C22H19Br2NO3 — CID 6567237
(1S,2R,6R,7R,8R,9S)-8,9-dibromo-4-[4-(4-methylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 6567237) has the molecular formula C22H19Br2NO3 and a molecular weight of 505.21 g/mol. Its IUPAC name is (1S,2R,6R,7R,8R,9S)-8,9-dibromo-4-[4-(4-methylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6R,7R,8R,9S)-8,9-dibromo-4-[4-(4-methylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 6567237 |
| Molecular Formula | C22H19Br2NO3 |
| Molecular Weight | 505.21 g/mol |
| Exact Mass | 502.97 |
| IUPAC Name | (1S,2R,6R,7R,8R,9S)-8,9-dibromo-4-[4-(4-methylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)[C@H]4[C@@H]5C[C@@H]([C@@H](Br)[C@H]5Br)[C@@H]4C3=O)cc2)cc1 |
| InChI | InChI=1S/C22H19Br2NO3/c1-11-2-6-13(7-3-11)28-14-8-4-12(5-9-14)25-21(26)17-15-10-16(18(17)22(25)27)20(24)19(15)23/h2-9,15-20H,10H2,1H3/t15-,16+,17-,18-,19-,20+/m0/s1 |
| InChIKey | KTXWRLRHUGGPSV-DWIKVQACSA-N |
| XLogP | 5.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.21 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|