C15H13Br2NO3 — CID 98455634
(1R,2S,6S,7R,8S,9S)-8,9-dibromo-4-(4-hydroxyphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98455634) has the molecular formula C15H13Br2NO3 and a molecular weight of 415.08 g/mol. Its IUPAC name is (1R,2S,6S,7R,8S,9S)-8,9-dibromo-4-(4-hydroxyphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6S,7R,8S,9S)-8,9-dibromo-4-(4-hydroxyphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98455634 |
| Molecular Formula | C15H13Br2NO3 |
| Molecular Weight | 415.08 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | (1R,2S,6S,7R,8S,9S)-8,9-dibromo-4-(4-hydroxyphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@@H]([C@H](Br)[C@H]3Br)[C@H]2C(=O)N1c1ccc(O)cc1 |
| InChI | InChI=1S/C15H13Br2NO3/c16-12-8-5-9(13(12)17)11-10(8)14(20)18(15(11)21)6-1-3-7(19)4-2-6/h1-4,8-13,19H,5H2/t8-,9-,10-,11-,12+,13+/m1/s1 |
| InChIKey | LNAWIYSKRBXEHT-PTEOKISQSA-N |
| XLogP | 2.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.08 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|