C21H16N2O5 — CID 59449490
4-[4-(4-methylphenoxy)phenyl]-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 59449490) has the molecular formula C21H16N2O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is 4-[4-(4-methylphenoxy)phenyl]-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 4-[4-(4-methylphenoxy)phenyl]-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 59449490 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-[4-(4-methylphenoxy)phenyl]-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)C4C5C(=O)NC(=O)C5C4C3=O)cc2)cc1 |
| InChI | InChI=1S/C21H16N2O5/c1-10-2-6-12(7-3-10)28-13-8-4-11(5-9-13)23-20(26)16-14-15(17(16)21(23)27)19(25)22-18(14)24/h2-9,14-17H,1H3,(H,22,24,25) |
| InChIKey | ACOYPWCRMGYNGO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|