C33H27NO3 — CID 126091167
(3aR,4R,7S,7aS)-2-[4-(4-methylphenoxy)phenyl]-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 126091167) has the molecular formula C33H27NO3 and a molecular weight of 485.58 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-2-[4-(4-methylphenoxy)phenyl]-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4R,7S,7aS)-2-[4-(4-methylphenoxy)phenyl]-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 126091167 |
| Molecular Formula | C33H27NO3 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (3aR,4R,7S,7aS)-2-[4-(4-methylphenoxy)phenyl]-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)[C@@H]4[C@H](C3=O)[C@H](c3ccccc3)C=C[C@@H]4c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H27NO3/c1-22-12-16-26(17-13-22)37-27-18-14-25(15-19-27)34-32(35)30-28(23-8-4-2-5-9-23)20-21-29(31(30)33(34)36)24-10-6-3-7-11-24/h2-21,28-31H,1H3/t28-,29+,30+,31- |
| InChIKey | XPRQTGVNGQWMRT-CZDYRZRFSA-N |
| XLogP | 7.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|