C26H20INO2 — CID 1127481
(3aR,4S,7R,7aS)-2-(4-iodophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 1127481) has the molecular formula C26H20INO2 and a molecular weight of 505.36 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-2-(4-iodophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aS)-2-(4-iodophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 1127481 |
| Molecular Formula | C26H20INO2 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | (3aR,4S,7R,7aS)-2-(4-iodophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccc(I)cc1)[C@@H](c1ccccc1)C=C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C26H20INO2/c27-19-11-13-20(14-12-19)28-25(29)23-21(17-7-3-1-4-8-17)15-16-22(24(23)26(28)30)18-9-5-2-6-10-18/h1-16,21-24H/t21-,22+,23-,24+ |
| InChIKey | SFWGUFOIKRCHQU-WAPCQROESA-N |
| XLogP | 5.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|