C27H20N2O2 — CID 56695839
4-(1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl)benzonitrile (PubChem CID 56695839) has the molecular formula C27H20N2O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-(1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl)benzonitrile.
| Compound Name | 4-(1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 56695839 |
| Molecular Formula | C27H20N2O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-(1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C3C(c4ccccc4)C=CC(c4ccccc4)C3C2=O)cc1 |
| InChI | InChI=1S/C27H20N2O2/c28-17-18-11-13-21(14-12-18)29-26(30)24-22(19-7-3-1-4-8-19)15-16-23(25(24)27(29)31)20-9-5-2-6-10-20/h1-16,22-25H |
| InChIKey | SIKXOLDWAUYIRC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|