C24H18N2O2 — CID 126373542
4-[(1S,2R,6R,7S)-3,5-dioxo-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile (PubChem CID 126373542) has the molecular formula C24H18N2O2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 4-[(1S,2R,6R,7S)-3,5-dioxo-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile.
| Compound Name | 4-[(1S,2R,6R,7S)-3,5-dioxo-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile |
|---|---|
| PubChem CID | 126373542 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-[(1S,2R,6R,7S)-3,5-dioxo-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile |
| SMILES | CC(=C1[C@H]2C=C[C@H]1[C@H]1C(=O)N(c3ccc(C#N)cc3)C(=O)[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C24H18N2O2/c1-14(16-5-3-2-4-6-16)20-18-11-12-19(20)22-21(18)23(27)26(24(22)28)17-9-7-15(13-25)8-10-17/h2-12,18-19,21-22H,1H3/t18-,19-,21-,22-/m1/s1 |
| InChIKey | RSXOGLUTSSUIDL-UGESXGAOSA-N |
| XLogP | 3.95 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|