C24H17ClF3NO2 — CID 126374133
(1S,2R,6R,7S)-4-[4-chloro-3-(trifluoromethyl)phenyl]-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126374133) has the molecular formula C24H17ClF3NO2 and a molecular weight of 443.85 g/mol. Its IUPAC name is (1S,2R,6R,7S)-4-[4-chloro-3-(trifluoromethyl)phenyl]-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S)-4-[4-chloro-3-(trifluoromethyl)phenyl]-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126374133 |
| Molecular Formula | C24H17ClF3NO2 |
| Molecular Weight | 443.85 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | (1S,2R,6R,7S)-4-[4-chloro-3-(trifluoromethyl)phenyl]-10-(1-phenylethylidene)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC(=C1[C@H]2C=C[C@H]1[C@H]1C(=O)N(c3ccc(Cl)c(C(F)(F)F)c3)C(=O)[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C24H17ClF3NO2/c1-12(13-5-3-2-4-6-13)19-15-8-9-16(19)21-20(15)22(30)29(23(21)31)14-7-10-18(25)17(11-14)24(26,27)28/h2-11,15-16,20-21H,1H3/t15-,16-,20-,21-/m1/s1 |
| InChIKey | PDEBELLZCKZYDC-IMAQQZIHSA-N |
| XLogP | 5.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.85 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|