C29H23NO2 — CID 98053249
(1S,2S,6S,7S)-10-benzhydrylidene-4-(4-methylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98053249) has the molecular formula C29H23NO2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (1S,2S,6S,7S)-10-benzhydrylidene-4-(4-methylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2S,6S,7S)-10-benzhydrylidene-4-(4-methylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98053249 |
| Molecular Formula | C29H23NO2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (1S,2S,6S,7S)-10-benzhydrylidene-4-(4-methylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@H]2C=C[C@@H]3C2=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23NO2/c1-18-12-14-21(15-13-18)30-28(31)26-22-16-17-23(27(26)29(30)32)25(22)24(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-17,22-23,26-27H,1H3/t22-,23-,26+,27+/m1/s1 |
| InChIKey | BZEVHHQWYHZHNK-YWUUFRFPSA-N |
| XLogP | 5.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|