C32H27NO3 — CID 1306884
(1R,2S,6R,7S)-4-(3-acetylphenyl)-10-[bis(4-methylphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 1306884) has the molecular formula C32H27NO3 and a molecular weight of 473.57 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-(3-acetylphenyl)-10-[bis(4-methylphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-(3-acetylphenyl)-10-[bis(4-methylphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 1306884 |
| Molecular Formula | C32H27NO3 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (1R,2S,6R,7S)-4-(3-acetylphenyl)-10-[bis(4-methylphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC(=O)c1cccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@H]3C2=C(c2ccc(C)cc2)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C32H27NO3/c1-18-7-11-21(12-8-18)27(22-13-9-19(2)10-14-22)28-25-15-16-26(28)30-29(25)31(35)33(32(30)36)24-6-4-5-23(17-24)20(3)34/h4-17,25-26,29-30H,1-3H3/t25-,26+,29-,30+ |
| InChIKey | DBUWPYDSLYIBCA-JXALSKIBSA-N |
| XLogP | 5.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|