C31H25NO4 — CID 98157541
(1R,2R,6R,7R)-4-(1,3-benzodioxol-5-yl)-10-[bis(4-methylphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98157541) has the molecular formula C31H25NO4 and a molecular weight of 475.54 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-(1,3-benzodioxol-5-yl)-10-[bis(4-methylphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-4-(1,3-benzodioxol-5-yl)-10-[bis(4-methylphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98157541 |
| Molecular Formula | C31H25NO4 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (1R,2R,6R,7R)-4-(1,3-benzodioxol-5-yl)-10-[bis(4-methylphenyl)methylidene]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cc1ccc(C(=C2[C@@H]3C=C[C@@H]2[C@H]2C(=O)N(c4ccc5c(c4)OCO5)C(=O)[C@@H]23)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H25NO4/c1-17-3-7-19(8-4-17)26(20-9-5-18(2)6-10-20)27-22-12-13-23(27)29-28(22)30(33)32(31(29)34)21-11-14-24-25(15-21)36-16-35-24/h3-15,22-23,28-29H,16H2,1-2H3/t22-,23-,28+,29+/m0/s1 |
| InChIKey | SQOQKSNNDLOWJL-BYSIJJKSSA-N |
| XLogP | 5.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|