C15H11NO5 — CID 4990142
2-(1,3-benzodioxol-5-yl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 4990142) has the molecular formula C15H11NO5 and a molecular weight of 285.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 4990142 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1C2C3C=CC(O3)C2C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H11NO5/c17-14-12-9-3-4-10(21-9)13(12)15(18)16(14)7-1-2-8-11(5-7)20-6-19-8/h1-5,9-10,12-13H,6H2 |
| InChIKey | NCCNODYUTCPTTK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|