C19H17NO3 — CID 159061016
(7aS)-2-naphthalen-2-yl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione;methane (PubChem CID 159061016) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (7aS)-2-naphthalen-2-yl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione;methane.
| Compound Name | (7aS)-2-naphthalen-2-yl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione;methane |
|---|---|
| PubChem CID | 159061016 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (7aS)-2-naphthalen-2-yl-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione;methane |
| SMILES | C.O=C1C2C3C=CC(O3)[C@H]2C(=O)N1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H13NO3.CH4/c20-17-15-13-7-8-14(22-13)16(15)18(21)19(17)12-6-5-10-3-1-2-4-11(10)9-12;/h1-9,13-16H;1H4/t13?,14?,15-,16?;/m1./s1 |
| InChIKey | JYLXTSJPZAYGTR-HJBJYVOXSA-N |
| XLogP | 2.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|