C16H16BrNO3 — CID 159660048
(7aS)-2-(4-bromo-3-methylphenyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione;methane (PubChem CID 159660048) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is (7aS)-2-(4-bromo-3-methylphenyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione;methane.
| Compound Name | (7aS)-2-(4-bromo-3-methylphenyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione;methane |
|---|---|
| PubChem CID | 159660048 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | (7aS)-2-(4-bromo-3-methylphenyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione;methane |
| SMILES | C.Cc1cc(N2C(=O)C3C4C=CC(O4)[C@H]3C2=O)ccc1Br |
| InChI | InChI=1S/C15H12BrNO3.CH4/c1-7-6-8(2-3-9(7)16)17-14(18)12-10-4-5-11(20-10)13(12)15(17)19;/h2-6,10-13H,1H3;1H4/t10?,11?,12-,13?;/m1./s1 |
| InChIKey | MSRKJTVCHMFSDQ-ZQRAKIMKSA-N |
| XLogP | 2.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|