C17H20BrNO3 — CID 160727901
(3aS)-2-(4-bromo-3-methylphenyl)-7-methyl-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione;methane (PubChem CID 160727901) has the molecular formula C17H20BrNO3 and a molecular weight of 366.26 g/mol. Its IUPAC name is (3aS)-2-(4-bromo-3-methylphenyl)-7-methyl-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione;methane.
| Compound Name | (3aS)-2-(4-bromo-3-methylphenyl)-7-methyl-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione;methane |
|---|---|
| PubChem CID | 160727901 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (3aS)-2-(4-bromo-3-methylphenyl)-7-methyl-4,5,6,7a-tetrahydro-3aH-4,7-epoxyisoindole-1,3-dione;methane |
| SMILES | C.Cc1cc(N2C(=O)C3[C@H](C2=O)C2CCC3(C)O2)ccc1Br |
| InChI | InChI=1S/C16H16BrNO3.CH4/c1-8-7-9(3-4-10(8)17)18-14(19)12-11-5-6-16(2,21-11)13(12)15(18)20;/h3-4,7,11-13H,5-6H2,1-2H3;1H4/t11?,12-,13?,16?;/m1./s1 |
| InChIKey | RTYIVWVLNVNAJL-HQRJOPSPSA-N |
| XLogP | 3.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|