C16H14BrNO3S — CID 11682361
(1S,2S,6R,7S)-4-(4-bromo-3-methylphenyl)-8-thia-4-azatricyclo[5.2.2.02,6]undecane-3,5,11-trione (PubChem CID 11682361) has the molecular formula C16H14BrNO3S and a molecular weight of 380.26 g/mol. Its IUPAC name is (1S,2S,6R,7S)-4-(4-bromo-3-methylphenyl)-8-thia-4-azatricyclo[5.2.2.02,6]undecane-3,5,11-trione.
| Compound Name | (1S,2S,6R,7S)-4-(4-bromo-3-methylphenyl)-8-thia-4-azatricyclo[5.2.2.02,6]undecane-3,5,11-trione |
|---|---|
| PubChem CID | 11682361 |
| Molecular Formula | C16H14BrNO3S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | (1S,2S,6R,7S)-4-(4-bromo-3-methylphenyl)-8-thia-4-azatricyclo[5.2.2.02,6]undecane-3,5,11-trione |
| SMILES | Cc1cc(N2C(=O)[C@H]3[C@H]4CS[C@H](C(=O)C4)[C@H]3C2=O)ccc1Br |
| InChI | InChI=1S/C16H14BrNO3S/c1-7-4-9(2-3-10(7)17)18-15(20)12-8-5-11(19)14(22-6-8)13(12)16(18)21/h2-4,8,12-14H,5-6H2,1H3/t8-,12+,13+,14-/m1/s1 |
| InChIKey | FIUIVGYYEBCHAI-DGJRKYIQSA-N |
| XLogP | 2.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|