C11H10BrNO2S — CID 112683688
4-(4-bromo-3-methylphenyl)thiomorpholine-3,5-dione (PubChem CID 112683688) has the molecular formula C11H10BrNO2S and a molecular weight of 300.18 g/mol. Its IUPAC name is 4-(4-bromo-3-methylphenyl)thiomorpholine-3,5-dione.
| Compound Name | 4-(4-bromo-3-methylphenyl)thiomorpholine-3,5-dione |
|---|---|
| PubChem CID | 112683688 |
| Molecular Formula | C11H10BrNO2S |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | 4-(4-bromo-3-methylphenyl)thiomorpholine-3,5-dione |
| SMILES | Cc1cc(N2C(=O)CSCC2=O)ccc1Br |
| InChI | InChI=1S/C11H10BrNO2S/c1-7-4-8(2-3-9(7)12)13-10(14)5-16-6-11(13)15/h2-4H,5-6H2,1H3 |
| InChIKey | UQSZQIVAPMCFAF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|