C14H19BrN2O — CID 117023514
4-(4-bromo-3-methylphenyl)-3,3-dimethyl-1,4-diazepan-5-one (PubChem CID 117023514) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is 4-(4-bromo-3-methylphenyl)-3,3-dimethyl-1,4-diazepan-5-one.
| Compound Name | 4-(4-bromo-3-methylphenyl)-3,3-dimethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 117023514 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-(4-bromo-3-methylphenyl)-3,3-dimethyl-1,4-diazepan-5-one |
| SMILES | Cc1cc(N2C(=O)CCNCC2(C)C)ccc1Br |
| InChI | InChI=1S/C14H19BrN2O/c1-10-8-11(4-5-12(10)15)17-13(18)6-7-16-9-14(17,2)3/h4-5,8,16H,6-7,9H2,1-3H3 |
| InChIKey | BQHPNTAJWRKWRM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |