C15H15BrN2O2 — CID 142660493
10-(4-bromo-3-methylphenyl)-4,10-diazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 142660493) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is 10-(4-bromo-3-methylphenyl)-4,10-diazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 10-(4-bromo-3-methylphenyl)-4,10-diazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 142660493 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 10-(4-bromo-3-methylphenyl)-4,10-diazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1cc(N2C3CCC2C2C(=O)NC(=O)C23)ccc1Br |
| InChI | InChI=1S/C15H15BrN2O2/c1-7-6-8(2-3-9(7)16)18-10-4-5-11(18)13-12(10)14(19)17-15(13)20/h2-3,6,10-13H,4-5H2,1H3,(H,17,19,20) |
| InChIKey | GLDLVTBEQLRPMT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|