C12H15BrN2O2 — CID 117010789
6-(aminomethyl)-3-(4-bromo-3-methylphenyl)-1,3-oxazinan-2-one (PubChem CID 117010789) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is 6-(aminomethyl)-3-(4-bromo-3-methylphenyl)-1,3-oxazinan-2-one.
| Compound Name | 6-(aminomethyl)-3-(4-bromo-3-methylphenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 117010789 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 6-(aminomethyl)-3-(4-bromo-3-methylphenyl)-1,3-oxazinan-2-one |
| SMILES | Cc1cc(N2CCC(CN)OC2=O)ccc1Br |
| InChI | InChI=1S/C12H15BrN2O2/c1-8-6-9(2-3-11(8)13)15-5-4-10(7-14)17-12(15)16/h2-3,6,10H,4-5,7,14H2,1H3 |
| InChIKey | JKGKRVGKWAPGGP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |