C12H14BrNO3 — CID 117009003
4-(4-bromo-3-methylphenyl)-6-(hydroxymethyl)morpholin-3-one (PubChem CID 117009003) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 4-(4-bromo-3-methylphenyl)-6-(hydroxymethyl)morpholin-3-one.
| Compound Name | 4-(4-bromo-3-methylphenyl)-6-(hydroxymethyl)morpholin-3-one |
|---|---|
| PubChem CID | 117009003 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 4-(4-bromo-3-methylphenyl)-6-(hydroxymethyl)morpholin-3-one |
| SMILES | Cc1cc(N2CC(CO)OCC2=O)ccc1Br |
| InChI | InChI=1S/C12H14BrNO3/c1-8-4-9(2-3-11(8)13)14-5-10(6-15)17-7-12(14)16/h2-4,10,15H,5-7H2,1H3 |
| InChIKey | GBCYIVYXYOTWAU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |