C15H18BrN3O4 — CID 46581535
ethyl N-[[1-(4-bromo-3-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamate (PubChem CID 46581535) has the molecular formula C15H18BrN3O4 and a molecular weight of 384.23 g/mol. Its IUPAC name is ethyl N-[[1-(4-bromo-3-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamate.
| Compound Name | ethyl N-[[1-(4-bromo-3-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 46581535 |
| Molecular Formula | C15H18BrN3O4 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | ethyl N-[[1-(4-bromo-3-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)C1CC(=O)N(c2ccc(Br)c(C)c2)C1 |
| InChI | InChI=1S/C15H18BrN3O4/c1-3-23-15(22)18-17-14(21)10-7-13(20)19(8-10)11-4-5-12(16)9(2)6-11/h4-6,10H,3,7-8H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | YJGRCVHIGADJPG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|