C17H16BrN3O4 — CID 42952579
1-(4-bromo-3-methylphenyl)-N'-(furan-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 42952579) has the molecular formula C17H16BrN3O4 and a molecular weight of 406.24 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-N'-(furan-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | 1-(4-bromo-3-methylphenyl)-N'-(furan-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 42952579 |
| Molecular Formula | C17H16BrN3O4 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-N'-(furan-2-carbonyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | Cc1cc(N2CC(C(=O)NNC(=O)c3ccco3)CC2=O)ccc1Br |
| InChI | InChI=1S/C17H16BrN3O4/c1-10-7-12(4-5-13(10)18)21-9-11(8-15(21)22)16(23)19-20-17(24)14-3-2-6-25-14/h2-7,11H,8-9H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | DDSZUEZCQLNWIG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|