C15H15BrN2O3 — CID 115946332
9-(4-bromo-3-methylphenyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione (PubChem CID 115946332) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is 9-(4-bromo-3-methylphenyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 9-(4-bromo-3-methylphenyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 115946332 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 9-(4-bromo-3-methylphenyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione |
| SMILES | Cc1cc(N2C(=O)NC(=O)C3(CCCC3)C2=O)ccc1Br |
| InChI | InChI=1S/C15H15BrN2O3/c1-9-8-10(4-5-11(9)16)18-13(20)15(6-2-3-7-15)12(19)17-14(18)21/h4-5,8H,2-3,6-7H2,1H3,(H,17,19,21) |
| InChIKey | QHTBKPCNKHPYSR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|