C11H6BrCl2NO2 — CID 2781117
1-(4-bromo-3-methylphenyl)-3,4-dichloropyrrole-2,5-dione (PubChem CID 2781117) has the molecular formula C11H6BrCl2NO2 and a molecular weight of 334.98 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3,4-dichloropyrrole-2,5-dione.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3,4-dichloropyrrole-2,5-dione |
|---|---|
| PubChem CID | 2781117 |
| Molecular Formula | C11H6BrCl2NO2 |
| Molecular Weight | 334.98 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3,4-dichloropyrrole-2,5-dione |
| SMILES | Cc1cc(N2C(=O)C(Cl)=C(Cl)C2=O)ccc1Br |
| InChI | InChI=1S/C11H6BrCl2NO2/c1-5-4-6(2-3-7(5)12)15-10(16)8(13)9(14)11(15)17/h2-4H,1H3 |
| InChIKey | UVJNAKWKPSDJIS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.98 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|