C18H13Cl2NO2 — CID 110584110
3-chloro-4-(4-chlorophenyl)-1-(3,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110584110) has the molecular formula C18H13Cl2NO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is 3-chloro-4-(4-chlorophenyl)-1-(3,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(4-chlorophenyl)-1-(3,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110584110 |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 3-chloro-4-(4-chlorophenyl)-1-(3,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(Cl)=C(c3ccc(Cl)cc3)C2=O)cc1C |
| InChI | InChI=1S/C18H13Cl2NO2/c1-10-3-8-14(9-11(10)2)21-17(22)15(16(20)18(21)23)12-4-6-13(19)7-5-12/h3-9H,1-2H3 |
| InChIKey | YVHLERUGECLTIY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|