C18H12ClF2NO2 — CID 110582201
3-chloro-1-(2,5-difluorophenyl)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110582201) has the molecular formula C18H12ClF2NO2 and a molecular weight of 347.75 g/mol. Its IUPAC name is 3-chloro-1-(2,5-difluorophenyl)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(2,5-difluorophenyl)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582201 |
| Molecular Formula | C18H12ClF2NO2 |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 3-chloro-1-(2,5-difluorophenyl)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(Cl)C(=O)N(c3cc(F)ccc3F)C2=O)cc1C |
| InChI | InChI=1S/C18H12ClF2NO2/c1-9-3-4-11(7-10(9)2)15-16(19)18(24)22(17(15)23)14-8-12(20)5-6-13(14)21/h3-8H,1-2H3 |
| InChIKey | LMFMFIMWMJYNRJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|