C25H19F2NO2S — CID 110550908
3-benzylsulfanyl-1-(2,5-difluorophenyl)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110550908) has the molecular formula C25H19F2NO2S and a molecular weight of 435.50 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-(2,5-difluorophenyl)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-benzylsulfanyl-1-(2,5-difluorophenyl)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110550908 |
| Molecular Formula | C25H19F2NO2S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 3-benzylsulfanyl-1-(2,5-difluorophenyl)-4-(3,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(SCc3ccccc3)C(=O)N(c3cc(F)ccc3F)C2=O)cc1C |
| InChI | InChI=1S/C25H19F2NO2S/c1-15-8-9-18(12-16(15)2)22-23(31-14-17-6-4-3-5-7-17)25(30)28(24(22)29)21-13-19(26)10-11-20(21)27/h3-13H,14H2,1-2H3 |
| InChIKey | FMJIEEXRHRNGJN-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|