C18H13ClFNO2 — CID 110582148
3-chloro-4-(3,4-dimethylphenyl)-1-(4-fluorophenyl)pyrrole-2,5-dione (PubChem CID 110582148) has the molecular formula C18H13ClFNO2 and a molecular weight of 329.76 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dimethylphenyl)-1-(4-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(3,4-dimethylphenyl)-1-(4-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582148 |
| Molecular Formula | C18H13ClFNO2 |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 3-chloro-4-(3,4-dimethylphenyl)-1-(4-fluorophenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(Cl)C(=O)N(c3ccc(F)cc3)C2=O)cc1C |
| InChI | InChI=1S/C18H13ClFNO2/c1-10-3-4-12(9-11(10)2)15-16(19)18(23)21(17(15)22)14-7-5-13(20)6-8-14/h3-9H,1-2H3 |
| InChIKey | GTRMPZIXLIHUBX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|