C20H18ClNO3 — CID 110582083
3-chloro-4-(3,4-dimethylphenyl)-1-(3-ethoxyphenyl)pyrrole-2,5-dione (PubChem CID 110582083) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dimethylphenyl)-1-(3-ethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(3,4-dimethylphenyl)-1-(3-ethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582083 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-chloro-4-(3,4-dimethylphenyl)-1-(3-ethoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCOc1cccc(N2C(=O)C(Cl)=C(c3ccc(C)c(C)c3)C2=O)c1 |
| InChI | InChI=1S/C20H18ClNO3/c1-4-25-16-7-5-6-15(11-16)22-19(23)17(18(21)20(22)24)14-9-8-12(2)13(3)10-14/h5-11H,4H2,1-3H3 |
| InChIKey | UIUMYUQXZJJPHX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|